About 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione
2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 95615144) has the molecular formula C14H17FN4S
and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
Molecular Properties
| Compound Name | 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| PubChem CID | 95615144 |
| Molecular Formula | C14H17FN4S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1cnn(CN2CC[C@H](c3ccccc3F)C2)c1=S |
| InChI | InChI=1S/C14H17FN4S/c1-17-9-16-19(14(17)20)10-18-7-6-11(8-18)12-4-2-3-5-13(12)15/h2-5,9,11H,6-8,10H2,1H3/t11-/m0/s1 |
| InChIKey | JXDXIOMREHPLCV-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione?
The IUPAC name of 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (CID 95615144) is 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
What is the SMILES notation for 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione?
The canonical SMILES for 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione is Cn1cnn(CN2CC[C@H](c3ccccc3F)C2)c1=S.
What is the InChIKey of 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione?
The InChIKey is JXDXIOMREHPLCV-NSHDSACASA-N. The full InChI is InChI=1S/C14H17FN4S/c1-17-9-16-19(14(17)20)10-18-7-6-11(8-18)12-4-2-3-5-13(12)15/h2-5,9,11H,6-8,10H2,1H3/t11-/m0/s1.
What are the key properties of 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione?
2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione has a molecular weight of 292.38 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methyl]-4-methyl-1,2,4-triazole-3-thione is sourced from PubChem (CID 95615144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).