C16H16FNO4S — CID 95615860
methyl 4-fluoro-3-[[[(3S)-oxolane-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 95615860) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is methyl 4-fluoro-3-[[[(3S)-oxolane-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 4-fluoro-3-[[[(3S)-oxolane-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 95615860 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | methyl 4-fluoro-3-[[[(3S)-oxolane-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cccc(F)c2c1CNC(=O)[C@H]1CCOC1 |
| InChI | InChI=1S/C16H16FNO4S/c1-21-16(20)14-10(7-18-15(19)9-5-6-22-8-9)13-11(17)3-2-4-12(13)23-14/h2-4,9H,5-8H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | IUNXNCCITWNQIO-VIFPVBQESA-N |
| XLogP | 2.48 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |