About 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one
2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one (PubChem CID 95616143) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one |
| PubChem CID | 95616143 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one |
| SMILES | CN1N=C(C(=O)N2CCCC[C@@H](N3CCCC3)C2)CCC1=O |
| InChI | InChI=1S/C16H26N4O2/c1-18-15(21)8-7-14(17-18)16(22)20-11-3-2-6-13(12-20)19-9-4-5-10-19/h13H,2-12H2,1H3/t13-/m1/s1 |
| InChIKey | SUUDRSIFMRFGNM-CYBMUJFWSA-N |
| XLogP | 1.07 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one (CID 95616143) is 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one is CN1N=C(C(=O)N2CCCC[C@@H](N3CCCC3)C2)CCC1=O.
What is the InChIKey of 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one?
The InChIKey is SUUDRSIFMRFGNM-CYBMUJFWSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-18-15(21)8-7-14(17-18)16(22)20-11-3-2-6-13(12-20)19-9-4-5-10-19/h13H,2-12H2,1H3/t13-/m1/s1.
What are the key properties of 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one?
2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one has a molecular weight of 306.41 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-[(3R)-3-pyrrolidin-1-ylazepane-1-carbonyl]-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 95616143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).