C17H33N3O — CID 95616410
2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N,N-diethylacetamide (PubChem CID 95616410) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N,N-diethylacetamide.
| Compound Name | 2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 95616410 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 2-[(3S)-3-(azepan-1-yl)piperidin-1-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN1CCC[C@H](N2CCCCCC2)C1 |
| InChI | InChI=1S/C17H33N3O/c1-3-19(4-2)17(21)15-18-11-9-10-16(14-18)20-12-7-5-6-8-13-20/h16H,3-15H2,1-2H3/t16-/m0/s1 |
| InChIKey | OQGOINAEOXTJPE-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |