C18H21NO4S — CID 95616819
N-[(S)-(2-methoxyphenyl)-phenylmethyl]-3-methylsulfonylpropanamide (PubChem CID 95616819) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[(S)-(2-methoxyphenyl)-phenylmethyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[(S)-(2-methoxyphenyl)-phenylmethyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 95616819 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[(S)-(2-methoxyphenyl)-phenylmethyl]-3-methylsulfonylpropanamide |
| SMILES | COc1ccccc1[C@@H](NC(=O)CCS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c1-23-16-11-7-6-10-15(16)18(14-8-4-3-5-9-14)19-17(20)12-13-24(2,21)22/h3-11,18H,12-13H2,1-2H3,(H,19,20)/t18-/m0/s1 |
| InChIKey | LDZOZTPWKQNBNE-SFHVURJKSA-N |
| XLogP | 2.34 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |