C15H22N6O3 — CID 95618087
N-[(2R)-1-(3,5-dimethylpyrazol-1-yl)propan-2-yl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide (PubChem CID 95618087) has the molecular formula C15H22N6O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[(2R)-1-(3,5-dimethylpyrazol-1-yl)propan-2-yl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[(2R)-1-(3,5-dimethylpyrazol-1-yl)propan-2-yl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 95618087 |
| Molecular Formula | C15H22N6O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[(2R)-1-(3,5-dimethylpyrazol-1-yl)propan-2-yl]-4-nitro-5-propyl-1H-pyrazole-3-carboxamide |
| SMILES | CCCc1[nH]nc(C(=O)N[C@H](C)Cn2nc(C)cc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N6O3/c1-5-6-12-14(21(23)24)13(18-17-12)15(22)16-10(3)8-20-11(4)7-9(2)19-20/h7,10H,5-6,8H2,1-4H3,(H,16,22)(H,17,18)/t10-/m1/s1 |
| InChIKey | GMEHGCBSTQJOMH-SNVBAGLBSA-N |
| XLogP | 1.90 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|