C19H23F3N6 — CID 95618207
3-[(2R)-6-[4-(trifluoromethyl)pyrimidin-2-yl]-6-azaspiro[2.5]octan-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 95618207) has the molecular formula C19H23F3N6 and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-[(2R)-6-[4-(trifluoromethyl)pyrimidin-2-yl]-6-azaspiro[2.5]octan-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[(2R)-6-[4-(trifluoromethyl)pyrimidin-2-yl]-6-azaspiro[2.5]octan-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 95618207 |
| Molecular Formula | C19H23F3N6 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 3-[(2R)-6-[4-(trifluoromethyl)pyrimidin-2-yl]-6-azaspiro[2.5]octan-2-yl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | FC(F)(F)c1ccnc(N2CCC3(CC2)C[C@H]3c2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C19H23F3N6/c20-19(21,22)14-5-8-23-17(24-14)27-10-6-18(7-11-27)12-13(18)16-26-25-15-4-2-1-3-9-28(15)16/h5,8,13H,1-4,6-7,9-12H2/t13-/m0/s1 |
| InChIKey | JYBXJLSXRPEKGI-ZDUSSCGKSA-N |
| XLogP | 3.59 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |