C16H12Cl2N2O — CID 95619124
(2S,4S)-4-(2,6-dichlorophenyl)-3-oxo-2-pyridin-2-ylpentanenitrile (PubChem CID 95619124) has the molecular formula C16H12Cl2N2O and a molecular weight of 319.19 g/mol. Its IUPAC name is (2S,4S)-4-(2,6-dichlorophenyl)-3-oxo-2-pyridin-2-ylpentanenitrile.
| Compound Name | (2S,4S)-4-(2,6-dichlorophenyl)-3-oxo-2-pyridin-2-ylpentanenitrile |
|---|---|
| PubChem CID | 95619124 |
| Molecular Formula | C16H12Cl2N2O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (2S,4S)-4-(2,6-dichlorophenyl)-3-oxo-2-pyridin-2-ylpentanenitrile |
| SMILES | C[C@H](C(=O)[C@H](C#N)c1ccccn1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H12Cl2N2O/c1-10(15-12(17)5-4-6-13(15)18)16(21)11(9-19)14-7-2-3-8-20-14/h2-8,10-11H,1H3/t10-,11+/m0/s1 |
| InChIKey | WMKQLFZFCXZRIP-WDEREUQCSA-N |
| XLogP | 4.37 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |