C17H27N3O3 — CID 95621245
(2E,4E)-1-[4-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one (PubChem CID 95621245) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is (2E,4E)-1-[4-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[4-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 95621245 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (2E,4E)-1-[4-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]piperazin-1-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1CCN([C@@H](C)C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C17H27N3O3/c1-3-4-5-6-16(21)19-9-7-18(8-10-19)15(2)17(22)20-11-13-23-14-12-20/h3-6,15H,7-14H2,1-2H3/b4-3+,6-5+/t15-/m0/s1 |
| InChIKey | RICRYDUYPCCOKB-BIVGAZQVSA-N |
| XLogP | 0.51 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|