C13H17N3O3S — CID 95621715
N-[4-[[(2R)-2-cyanomorpholin-4-yl]methyl]phenyl]methanesulfonamide (PubChem CID 95621715) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[4-[[(2R)-2-cyanomorpholin-4-yl]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[[(2R)-2-cyanomorpholin-4-yl]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 95621715 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[4-[[(2R)-2-cyanomorpholin-4-yl]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(CN2CCO[C@@H](C#N)C2)cc1 |
| InChI | InChI=1S/C13H17N3O3S/c1-20(17,18)15-12-4-2-11(3-5-12)9-16-6-7-19-13(8-14)10-16/h2-5,13,15H,6-7,9-10H2,1H3/t13-/m0/s1 |
| InChIKey | VNHNAUHYVFCBIE-ZDUSSCGKSA-N |
| XLogP | 0.78 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |