C18H17F2NO3 — CID 95623125
[4-(2,4-difluorophenoxy)phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone (PubChem CID 95623125) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is [4-(2,4-difluorophenoxy)phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone.
| Compound Name | [4-(2,4-difluorophenoxy)phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 95623125 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [4-(2,4-difluorophenoxy)phenyl]-[(3R)-3-hydroxypiperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Oc2ccc(F)cc2F)cc1)N1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C18H17F2NO3/c19-13-5-8-17(16(20)10-13)24-15-6-3-12(4-7-15)18(23)21-9-1-2-14(22)11-21/h3-8,10,14,22H,1-2,9,11H2/t14-/m1/s1 |
| InChIKey | XIXUMFKIGGSHOZ-CQSZACIVSA-N |
| XLogP | 3.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |