About (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide
(2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide (PubChem CID 95623668) has the molecular formula C14H22N2O6S
and a molecular weight of 346.41 g/mol. Its IUPAC name is (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide.
Molecular Properties
| Compound Name | (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide |
| PubChem CID | 95623668 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide |
| SMILES | COC[C@@](C)(NS(=O)(=O)c1cc(OC)c(OC)cc1C)C(N)=O |
| InChI | InChI=1S/C14H22N2O6S/c1-9-6-10(21-4)11(22-5)7-12(9)23(18,19)16-14(2,8-20-3)13(15)17/h6-7,16H,8H2,1-5H3,(H2,15,17)/t14-/m1/s1 |
| InChIKey | MOFLXCVXVZZPIR-CQSZACIVSA-N |
| XLogP | 0.18 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide?
The IUPAC name of (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide (CID 95623668) is (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide.
What is the SMILES notation for (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide?
The canonical SMILES for (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide is COC[C@@](C)(NS(=O)(=O)c1cc(OC)c(OC)cc1C)C(N)=O.
What is the InChIKey of (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide?
The InChIKey is MOFLXCVXVZZPIR-CQSZACIVSA-N. The full InChI is InChI=1S/C14H22N2O6S/c1-9-6-10(21-4)11(22-5)7-12(9)23(18,19)16-14(2,8-20-3)13(15)17/h6-7,16H,8H2,1-5H3,(H2,15,17)/t14-/m1/s1.
What are the key properties of (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide?
(2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide has a molecular weight of 346.41 g/mol, XLogP of 0.18, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4,5-dimethoxy-2-methylphenyl)sulfonylamino]-3-methoxy-2-methylpropanamide is sourced from PubChem (CID 95623668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).