C18H23NO4 — CID 95624542
(3S)-3-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methylamino]oxolan-2-one (PubChem CID 95624542) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is (3S)-3-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methylamino]oxolan-2-one.
| Compound Name | (3S)-3-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methylamino]oxolan-2-one |
|---|---|
| PubChem CID | 95624542 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (3S)-3-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methylamino]oxolan-2-one |
| SMILES | O=C1OCC[C@@H]1NCC1(c2ccc3c(c2)OCO3)CCCCC1 |
| InChI | InChI=1S/C18H23NO4/c20-17-14(6-9-21-17)19-11-18(7-2-1-3-8-18)13-4-5-15-16(10-13)23-12-22-15/h4-5,10,14,19H,1-3,6-9,11-12H2/t14-/m0/s1 |
| InChIKey | YRQHOPKRYYSQAU-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |