C16H15FN4O3 — CID 95624732
(3S)-1-(2-fluorophenyl)-3-[methyl-(5-nitro-2-pyridinyl)amino]pyrrolidin-2-one (PubChem CID 95624732) has the molecular formula C16H15FN4O3 and a molecular weight of 330.32 g/mol. Its IUPAC name is (3S)-1-(2-fluorophenyl)-3-[methyl-(5-nitro-2-pyridinyl)amino]pyrrolidin-2-one.
| Compound Name | (3S)-1-(2-fluorophenyl)-3-[methyl-(5-nitro-2-pyridinyl)amino]pyrrolidin-2-one |
|---|---|
| PubChem CID | 95624732 |
| Molecular Formula | C16H15FN4O3 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (3S)-1-(2-fluorophenyl)-3-[methyl-(5-nitro-2-pyridinyl)amino]pyrrolidin-2-one |
| SMILES | CN(c1ccc([N+](=O)[O-])cn1)[C@H]1CCN(c2ccccc2F)C1=O |
| InChI | InChI=1S/C16H15FN4O3/c1-19(15-7-6-11(10-18-15)21(23)24)14-8-9-20(16(14)22)13-5-3-2-4-12(13)17/h2-7,10,14H,8-9H2,1H3/t14-/m0/s1 |
| InChIKey | XBQIWCPBDXMQRC-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|