C16H21N3O3 — CID 95625533
N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]-1H-indazole-4-carboxamide (PubChem CID 95625533) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]-1H-indazole-4-carboxamide.
| Compound Name | N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]-1H-indazole-4-carboxamide |
|---|---|
| PubChem CID | 95625533 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[3-[[(2R)-oxolan-2-yl]methoxy]propyl]-1H-indazole-4-carboxamide |
| SMILES | O=C(NCCCOC[C@H]1CCCO1)c1cccc2[nH]ncc12 |
| InChI | InChI=1S/C16H21N3O3/c20-16(13-5-1-6-15-14(13)10-18-19-15)17-7-3-8-21-11-12-4-2-9-22-12/h1,5-6,10,12H,2-4,7-9,11H2,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | GSYPOUZWXNBCEH-GFCCVEGCSA-N |
| XLogP | 1.88 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|