About N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide
N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide (PubChem CID 95627815) has the molecular formula C16H16F2N2O2
and a molecular weight of 306.31 g/mol. Its IUPAC name is N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide |
| PubChem CID | 95627815 |
| Molecular Formula | C16H16F2N2O2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide |
| SMILES | Cc1cccc(C(=O)NC[C@](C)(O)c2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C16H16F2N2O2/c1-10-4-3-5-14(20-10)15(21)19-9-16(2,22)12-7-6-11(17)8-13(12)18/h3-8,22H,9H2,1-2H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | YLEPZOYTURVWKR-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide?
The IUPAC name of N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide (CID 95627815) is N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide.
What is the SMILES notation for N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide?
The canonical SMILES for N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide is Cc1cccc(C(=O)NC[C@](C)(O)c2ccc(F)cc2F)n1.
What is the InChIKey of N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide?
The InChIKey is YLEPZOYTURVWKR-INIZCTEOSA-N. The full InChI is InChI=1S/C16H16F2N2O2/c1-10-4-3-5-14(20-10)15(21)19-9-16(2,22)12-7-6-11(17)8-13(12)18/h3-8,22H,9H2,1-2H3,(H,19,21)/t16-/m0/s1.
What are the key properties of N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide?
N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide has a molecular weight of 306.31 g/mol, XLogP of 2.31, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-(2,4-difluorophenyl)-2-hydroxypropyl]-6-methylpyridine-2-carboxamide is sourced from PubChem (CID 95627815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).