C16H28N2O2 — CID 95627842
2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 95627842) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 95627842 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCC[C@]2(CC=CCC2)C1 |
| InChI | InChI=1S/C16H28N2O2/c1-20-12-6-10-17-15(19)13-18-11-5-9-16(14-18)7-3-2-4-8-16/h2-3H,4-14H2,1H3,(H,17,19)/t16-/m1/s1 |
| InChIKey | PORFEDZQRHFOMI-MRXNPFEDSA-N |
| XLogP | 1.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|