About N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide
N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide (PubChem CID 95628680) has the molecular formula C13H20F2N2O3S
and a molecular weight of 322.38 g/mol. Its IUPAC name is N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide |
| PubChem CID | 95628680 |
| Molecular Formula | C13H20F2N2O3S |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide |
| SMILES | COCCS(=O)(=O)NC[C@H](c1c(F)cccc1F)N(C)C |
| InChI | InChI=1S/C13H20F2N2O3S/c1-17(2)12(9-16-21(18,19)8-7-20-3)13-10(14)5-4-6-11(13)15/h4-6,12,16H,7-9H2,1-3H3/t12-/m1/s1 |
| InChIKey | IJHWKXOYRWCDHT-GFCCVEGCSA-N |
| XLogP | 1.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide?
The IUPAC name of N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide (CID 95628680) is N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide.
What is the SMILES notation for N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide?
The canonical SMILES for N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide is COCCS(=O)(=O)NC[C@H](c1c(F)cccc1F)N(C)C.
What is the InChIKey of N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide?
The InChIKey is IJHWKXOYRWCDHT-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H20F2N2O3S/c1-17(2)12(9-16-21(18,19)8-7-20-3)13-10(14)5-4-6-11(13)15/h4-6,12,16H,7-9H2,1-3H3/t12-/m1/s1.
What are the key properties of N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide?
N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide has a molecular weight of 322.38 g/mol, XLogP of 1.13, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-(2,6-difluorophenyl)-2-(dimethylamino)ethyl]-2-methoxyethanesulfonamide is sourced from PubChem (CID 95628680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).