C18H19ClN2O2 — CID 95629458
[(2R)-2-(4-chlorophenyl)azepan-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone (PubChem CID 95629458) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.81 g/mol. Its IUPAC name is [(2R)-2-(4-chlorophenyl)azepan-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone.
| Compound Name | [(2R)-2-(4-chlorophenyl)azepan-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone |
|---|---|
| PubChem CID | 95629458 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [(2R)-2-(4-chlorophenyl)azepan-1-yl]-(1-oxidopyridin-1-ium-2-yl)methanone |
| SMILES | O=C(c1cccc[n+]1[O-])N1CCCCC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2O2/c19-15-10-8-14(9-11-15)16-6-2-1-4-12-20(16)18(22)17-7-3-5-13-21(17)23/h3,5,7-11,13,16H,1-2,4,6,12H2/t16-/m1/s1 |
| InChIKey | YGLDNBORSALRHC-MRXNPFEDSA-N |
| XLogP | 3.73 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|