C10H17F3N2O3 — CID 95631540
(2R)-N-(2-methoxyethyl)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidine-1-carboxamide (PubChem CID 95631540) has the molecular formula C10H17F3N2O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is (2R)-N-(2-methoxyethyl)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(2-methoxyethyl)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 95631540 |
| Molecular Formula | C10H17F3N2O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2R)-N-(2-methoxyethyl)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCC[C@@H]1[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O3/c1-18-6-4-14-9(17)15-5-2-3-7(15)8(16)10(11,12)13/h7-8,16H,2-6H2,1H3,(H,14,17)/t7-,8-/m1/s1 |
| InChIKey | FDFOAODBJPNGLQ-HTQZYQBOSA-N |
| XLogP | 0.73 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|