C16H24N4O2S — CID 95633448
2-[4-[[[(2R)-2-methylsulfanylpropanoyl]amino]methyl]piperidin-1-yl]pyridine-3-carboxamide (PubChem CID 95633448) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-[4-[[[(2R)-2-methylsulfanylpropanoyl]amino]methyl]piperidin-1-yl]pyridine-3-carboxamide.
| Compound Name | 2-[4-[[[(2R)-2-methylsulfanylpropanoyl]amino]methyl]piperidin-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95633448 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-[4-[[[(2R)-2-methylsulfanylpropanoyl]amino]methyl]piperidin-1-yl]pyridine-3-carboxamide |
| SMILES | CS[C@H](C)C(=O)NCC1CCN(c2ncccc2C(N)=O)CC1 |
| InChI | InChI=1S/C16H24N4O2S/c1-11(23-2)16(22)19-10-12-5-8-20(9-6-12)15-13(14(17)21)4-3-7-18-15/h3-4,7,11-12H,5-6,8-10H2,1-2H3,(H2,17,21)(H,19,22)/t11-/m1/s1 |
| InChIKey | MHVNAKKDCBBHBV-LLVKDONJSA-N |
| XLogP | 1.26 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |