About [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate
[(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate (PubChem CID 95635924) has the molecular formula C12H11NO5
and a molecular weight of 249.22 g/mol. Its IUPAC name is [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate.
Molecular Properties
| Compound Name | [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate |
| PubChem CID | 95635924 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate |
| SMILES | C#C[C@@H](C)OC(=O)c1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C12H11NO5/c1-4-8(2)18-12(14)10-7-9(13(15)16)5-6-11(10)17-3/h1,5-8H,2-3H3/t8-/m1/s1 |
| InChIKey | PICVFPKOXIZURM-MRVPVSSYSA-N |
| XLogP | 1.78 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate?
The IUPAC name of [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate (CID 95635924) is [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate.
What is the SMILES notation for [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate?
The canonical SMILES for [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate is C#C[C@@H](C)OC(=O)c1cc([N+](=O)[O-])ccc1OC.
What is the InChIKey of [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate?
The InChIKey is PICVFPKOXIZURM-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H11NO5/c1-4-8(2)18-12(14)10-7-9(13(15)16)5-6-11(10)17-3/h1,5-8H,2-3H3/t8-/m1/s1.
What are the key properties of [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate?
[(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate has a molecular weight of 249.22 g/mol, XLogP of 1.78, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-but-3-yn-2-yl] 2-methoxy-5-nitrobenzoate is sourced from PubChem (CID 95635924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).