C17H24N4O4 — CID 95636491
N-carbamoyl-2-[2-[(2R)-2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]acetamide (PubChem CID 95636491) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-carbamoyl-2-[2-[(2R)-2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]acetamide.
| Compound Name | N-carbamoyl-2-[2-[(2R)-2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]acetamide |
|---|---|
| PubChem CID | 95636491 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-carbamoyl-2-[2-[(2R)-2-(2-hydroxyethyl)piperidine-1-carbonyl]anilino]acetamide |
| SMILES | NC(=O)NC(=O)CNc1ccccc1C(=O)N1CCCC[C@@H]1CCO |
| InChI | InChI=1S/C17H24N4O4/c18-17(25)20-15(23)11-19-14-7-2-1-6-13(14)16(24)21-9-4-3-5-12(21)8-10-22/h1-2,6-7,12,19,22H,3-5,8-11H2,(H3,18,20,23,25)/t12-/m1/s1 |
| InChIKey | ZWJJOONXWXDPMR-GFCCVEGCSA-N |
| XLogP | 0.67 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |