C13H16N6O3 — CID 95639451
2-[(Z)-[(3aR,8bS)-3a,8b-dihydroxy-1,3-dimethyl-2-oxoindeno[1,2-d]imidazol-4-ylidene]amino]guanidine (PubChem CID 95639451) has the molecular formula C13H16N6O3 and a molecular weight of 304.31 g/mol. Its IUPAC name is 2-[(Z)-[(3aR,8bS)-3a,8b-dihydroxy-1,3-dimethyl-2-oxoindeno[1,2-d]imidazol-4-ylidene]amino]guanidine.
| Compound Name | 2-[(Z)-[(3aR,8bS)-3a,8b-dihydroxy-1,3-dimethyl-2-oxoindeno[1,2-d]imidazol-4-ylidene]amino]guanidine |
|---|---|
| PubChem CID | 95639451 |
| Molecular Formula | C13H16N6O3 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[(Z)-[(3aR,8bS)-3a,8b-dihydroxy-1,3-dimethyl-2-oxoindeno[1,2-d]imidazol-4-ylidene]amino]guanidine |
| SMILES | CN1C(=O)N(C)[C@@]2(O)/C(=N\N=C(N)N)c3ccccc3[C@@]12O |
| InChI | InChI=1S/C13H16N6O3/c1-18-11(20)19(2)13(22)9(16-17-10(14)15)7-5-3-4-6-8(7)12(13,18)21/h3-6,21-22H,1-2H3,(H4,14,15,17)/b16-9-/t12-,13+/m0/s1 |
| InChIKey | XNRCEXRQHOPNNB-AMCJRTCWSA-N |
| XLogP | -1.49 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|