About N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine
N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 956411) has the molecular formula C11H11FN2S
and a molecular weight of 222.29 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine |
| PubChem CID | 956411 |
| Molecular Formula | C11H11FN2S |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(Nc2ccc(F)cc2)sc1C |
| InChI | InChI=1S/C11H11FN2S/c1-7-8(2)15-11(13-7)14-10-5-3-9(12)4-6-10/h3-6H,1-2H3,(H,13,14) |
| InChIKey | BENMNUDQVXKCFT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine?
The IUPAC name of N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine (CID 956411) is N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine.
What is the SMILES notation for N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine?
The canonical SMILES for N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine is Cc1nc(Nc2ccc(F)cc2)sc1C.
What is the InChIKey of N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine?
The InChIKey is BENMNUDQVXKCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2S/c1-7-8(2)15-11(13-7)14-10-5-3-9(12)4-6-10/h3-6H,1-2H3,(H,13,14).
What are the key properties of N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine?
N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine has a molecular weight of 222.29 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-4,5-dimethyl-1,3-thiazol-2-amine is sourced from PubChem (CID 956411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).