About (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine
(2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine (PubChem CID 95656913) has the molecular formula C14H16F6N2
and a molecular weight of 326.28 g/mol. Its IUPAC name is (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine.
Molecular Properties
| Compound Name | (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine |
| PubChem CID | 95656913 |
| Molecular Formula | C14H16F6N2 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine |
| SMILES | C[C@@H]1CNCCN1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F6N2/c1-9-7-21-2-3-22(9)8-10-4-11(13(15,16)17)6-12(5-10)14(18,19)20/h4-6,9,21H,2-3,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | IQWLVBMZMPTXIJ-SECBINFHSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine?
The IUPAC name of (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine (CID 95656913) is (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine.
What is the SMILES notation for (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine?
The canonical SMILES for (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine is C[C@@H]1CNCCN1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine?
The InChIKey is IQWLVBMZMPTXIJ-SECBINFHSA-N. The full InChI is InChI=1S/C14H16F6N2/c1-9-7-21-2-3-22(9)8-10-4-11(13(15,16)17)6-12(5-10)14(18,19)20/h4-6,9,21H,2-3,7-8H2,1H3/t9-/m1/s1.
What are the key properties of (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine?
(2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine has a molecular weight of 326.28 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methylpiperazine is sourced from PubChem (CID 95656913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).