C16H20N2O4 — CID 95657929
(3R)-8-methyl-4-(pyridine-3-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid (PubChem CID 95657929) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3R)-8-methyl-4-(pyridine-3-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | (3R)-8-methyl-4-(pyridine-3-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 95657929 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (3R)-8-methyl-4-(pyridine-3-carbonyl)-1-oxa-4-azaspiro[4.5]decane-3-carboxylic acid |
| SMILES | CC1CCC2(CC1)OC[C@H](C(=O)O)N2C(=O)c1cccnc1 |
| InChI | InChI=1S/C16H20N2O4/c1-11-4-6-16(7-5-11)18(13(10-22-16)15(20)21)14(19)12-3-2-8-17-9-12/h2-3,8-9,11,13H,4-7,10H2,1H3,(H,20,21)/t11?,13-,16?/m1/s1 |
| InChIKey | GSXWTMGLYZDMDT-RYCVTPFZSA-N |
| XLogP | 1.91 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |