C22H32N2O4 — CID 95658658
(3S)-8-benzyl-4-heptanoyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid (PubChem CID 95658658) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is (3S)-8-benzyl-4-heptanoyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid.
| Compound Name | (3S)-8-benzyl-4-heptanoyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
|---|---|
| PubChem CID | 95658658 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (3S)-8-benzyl-4-heptanoyl-1-oxa-4,8-diazaspiro[4.5]decane-3-carboxylic acid |
| SMILES | CCCCCCC(=O)N1[C@H](C(=O)O)COC12CCN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C22H32N2O4/c1-2-3-4-8-11-20(25)24-19(21(26)27)17-28-22(24)12-14-23(15-13-22)16-18-9-6-5-7-10-18/h5-7,9-10,19H,2-4,8,11-17H2,1H3,(H,26,27)/t19-/m0/s1 |
| InChIKey | LGQHLDDIFFTYME-IBGZPJMESA-N |
| XLogP | 3.26 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|