C11H14N2O3 — CID 95692133
(5S)-5-(2,5-dimethylfuran-3-yl)-3,5-dimethylimidazolidine-2,4-dione (PubChem CID 95692133) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (5S)-5-(2,5-dimethylfuran-3-yl)-3,5-dimethylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(2,5-dimethylfuran-3-yl)-3,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95692133 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (5S)-5-(2,5-dimethylfuran-3-yl)-3,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1cc([C@]2(C)NC(=O)N(C)C2=O)c(C)o1 |
| InChI | InChI=1S/C11H14N2O3/c1-6-5-8(7(2)16-6)11(3)9(14)13(4)10(15)12-11/h5H,1-4H3,(H,12,15)/t11-/m0/s1 |
| InChIKey | YEOSQBXTCNMQTM-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|