C16H18BrN3O3S — CID 95706261
3-[4-bromo-3-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]-1H-pyridazin-6-one (PubChem CID 95706261) has the molecular formula C16H18BrN3O3S and a molecular weight of 412.31 g/mol. Its IUPAC name is 3-[4-bromo-3-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]-1H-pyridazin-6-one.
| Compound Name | 3-[4-bromo-3-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 95706261 |
| Molecular Formula | C16H18BrN3O3S |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 3-[4-bromo-3-[(3S)-3-methylpiperidin-1-yl]sulfonylphenyl]-1H-pyridazin-6-one |
| SMILES | C[C@H]1CCCN(S(=O)(=O)c2cc(-c3ccc(=O)[nH]n3)ccc2Br)C1 |
| InChI | InChI=1S/C16H18BrN3O3S/c1-11-3-2-8-20(10-11)24(22,23)15-9-12(4-5-13(15)17)14-6-7-16(21)19-18-14/h4-7,9,11H,2-3,8,10H2,1H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | GENGDEHBYDBFFI-NSHDSACASA-N |
| XLogP | 2.62 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |