C19H22N2O3 — CID 95706566
3-[[(2S)-2-(2,4-dimethylphenoxy)propanoyl]amino]-2-methylbenzamide (PubChem CID 95706566) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-[[(2S)-2-(2,4-dimethylphenoxy)propanoyl]amino]-2-methylbenzamide.
| Compound Name | 3-[[(2S)-2-(2,4-dimethylphenoxy)propanoyl]amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 95706566 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 3-[[(2S)-2-(2,4-dimethylphenoxy)propanoyl]amino]-2-methylbenzamide |
| SMILES | Cc1ccc(O[C@@H](C)C(=O)Nc2cccc(C(N)=O)c2C)c(C)c1 |
| InChI | InChI=1S/C19H22N2O3/c1-11-8-9-17(12(2)10-11)24-14(4)19(23)21-16-7-5-6-15(13(16)3)18(20)22/h5-10,14H,1-4H3,(H2,20,22)(H,21,23)/t14-/m0/s1 |
| InChIKey | FZXJWMJKDHMDAS-AWEZNQCLSA-N |
| XLogP | 3.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |