C21H32FN3O2 — CID 95707487
(3R)-1-(6-aminohexanoyl)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-5-one (PubChem CID 95707487) has the molecular formula C21H32FN3O2 and a molecular weight of 377.50 g/mol. Its IUPAC name is (3R)-1-(6-aminohexanoyl)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-5-one.
| Compound Name | (3R)-1-(6-aminohexanoyl)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 95707487 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | (3R)-1-(6-aminohexanoyl)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-5-one |
| SMILES | CC(C)[C@@H]1CN(C(=O)CCCCCN)CCC(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H32FN3O2/c1-16(2)19-15-24(20(26)6-4-3-5-12-23)13-11-21(27)25(19)14-17-7-9-18(22)10-8-17/h7-10,16,19H,3-6,11-15,23H2,1-2H3/t19-/m0/s1 |
| InChIKey | ANLJPKKVDRFLNQ-IBGZPJMESA-N |
| XLogP | 2.93 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|