C20H27N3O3 — CID 95707901
[(6S)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]-(1,3,7-trimethylindol-2-yl)methanone (PubChem CID 95707901) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is [(6S)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]-(1,3,7-trimethylindol-2-yl)methanone.
| Compound Name | [(6S)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]-(1,3,7-trimethylindol-2-yl)methanone |
|---|---|
| PubChem CID | 95707901 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | [(6S)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-4-yl]-(1,3,7-trimethylindol-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCO[C@@]3(CNCCOC3)C2)n(C)c2c(C)cccc12 |
| InChI | InChI=1S/C20H27N3O3/c1-14-5-4-6-16-15(2)18(22(3)17(14)16)19(24)23-8-10-26-20(12-23)11-21-7-9-25-13-20/h4-6,21H,7-13H2,1-3H3/t20-/m0/s1 |
| InChIKey | SOLMQURLLIYFNO-FQEVSTJZSA-N |
| XLogP | 1.63 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|