C15H17F3N2O4S — CID 95709705
(5R)-3-methyl-9-(2,4,5-trifluorophenyl)sulfonyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (PubChem CID 95709705) has the molecular formula C15H17F3N2O4S and a molecular weight of 378.37 g/mol. Its IUPAC name is (5R)-3-methyl-9-(2,4,5-trifluorophenyl)sulfonyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | (5R)-3-methyl-9-(2,4,5-trifluorophenyl)sulfonyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 95709705 |
| Molecular Formula | C15H17F3N2O4S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | (5R)-3-methyl-9-(2,4,5-trifluorophenyl)sulfonyl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| SMILES | CN1C[C@]2(CCCN(S(=O)(=O)c3cc(F)c(F)cc3F)CC2)OC1=O |
| InChI | InChI=1S/C15H17F3N2O4S/c1-19-9-15(24-14(19)21)3-2-5-20(6-4-15)25(22,23)13-8-11(17)10(16)7-12(13)18/h7-8H,2-6,9H2,1H3/t15-/m1/s1 |
| InChIKey | MNYKNMRFLJOJHZ-OAHLLOKOSA-N |
| XLogP | 2.10 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|