C30H42O12 — CID 95709950
[(2S,3R)-3-[3,4-bis(ethoxymethoxy)phenyl]oxiran-2-yl]-[2,4,6-tris(ethoxymethoxy)phenyl]methanone (PubChem CID 95709950) has the molecular formula C30H42O12 and a molecular weight of 594.65 g/mol. Its IUPAC name is [(2S,3R)-3-[3,4-bis(ethoxymethoxy)phenyl]oxiran-2-yl]-[2,4,6-tris(ethoxymethoxy)phenyl]methanone.
| Compound Name | [(2S,3R)-3-[3,4-bis(ethoxymethoxy)phenyl]oxiran-2-yl]-[2,4,6-tris(ethoxymethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 95709950 |
| Molecular Formula | C30H42O12 |
| Molecular Weight | 594.65 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | [(2S,3R)-3-[3,4-bis(ethoxymethoxy)phenyl]oxiran-2-yl]-[2,4,6-tris(ethoxymethoxy)phenyl]methanone |
| SMILES | CCOCOc1cc(OCOCC)c(C(=O)[C@H]2O[C@@H]2c2ccc(OCOCC)c(OCOCC)c2)c(OCOCC)c1 |
| InChI | InChI=1S/C30H42O12/c1-6-32-16-37-22-14-25(40-19-35-9-4)27(26(15-22)41-20-36-10-5)28(31)30-29(42-30)21-11-12-23(38-17-33-7-2)24(13-21)39-18-34-8-3/h11-15,29-30H,6-10,16-20H2,1-5H3/t29-,30-/m1/s1 |
| InChIKey | WRWKJNHZPLBAPY-LOYHVIPDSA-N |
| XLogP | 4.87 |
| TPSA | 121.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.65 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|