About 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine
4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine (PubChem CID 95712281) has the molecular formula C14H18ClN3O
and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
| PubChem CID | 95712281 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine |
| SMILES | Clc1cc(NCCC[C@H]2CCOC2)nc2[nH]ccc12 |
| InChI | InChI=1S/C14H18ClN3O/c15-12-8-13(18-14-11(12)3-6-17-14)16-5-1-2-10-4-7-19-9-10/h3,6,8,10H,1-2,4-5,7,9H2,(H2,16,17,18)/t10-/m0/s1 |
| InChIKey | JRZRBIQWNOPDNZ-JTQLQIEISA-N |
| XLogP | 3.44 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
The IUPAC name of 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine (CID 95712281) is 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine.
What is the SMILES notation for 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
The canonical SMILES for 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine is Clc1cc(NCCC[C@H]2CCOC2)nc2[nH]ccc12.
What is the InChIKey of 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
The InChIKey is JRZRBIQWNOPDNZ-JTQLQIEISA-N. The full InChI is InChI=1S/C14H18ClN3O/c15-12-8-13(18-14-11(12)3-6-17-14)16-5-1-2-10-4-7-19-9-10/h3,6,8,10H,1-2,4-5,7,9H2,(H2,16,17,18)/t10-/m0/s1.
What are the key properties of 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine?
4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine has a molecular weight of 279.77 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[3-[(3S)-oxolan-3-yl]propyl]-1H-pyrrolo[2,3-b]pyridin-6-amine is sourced from PubChem (CID 95712281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).