C14H19F3N4O2 — CID 95712319
N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-[(3S)-morpholin-3-yl]acetamide (PubChem CID 95712319) has the molecular formula C14H19F3N4O2 and a molecular weight of 332.33 g/mol. Its IUPAC name is N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-[(3S)-morpholin-3-yl]acetamide.
| Compound Name | N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-[(3S)-morpholin-3-yl]acetamide |
|---|---|
| PubChem CID | 95712319 |
| Molecular Formula | C14H19F3N4O2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[2-[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]ethyl]-2-[(3S)-morpholin-3-yl]acetamide |
| SMILES | Cc1cc(C(F)(F)F)nc(CCNC(=O)C[C@H]2COCCN2)n1 |
| InChI | InChI=1S/C14H19F3N4O2/c1-9-6-11(14(15,16)17)21-12(20-9)2-3-19-13(22)7-10-8-23-5-4-18-10/h6,10,18H,2-5,7-8H2,1H3,(H,19,22)/t10-/m0/s1 |
| InChIKey | GBWGKAXWIMBIPS-JTQLQIEISA-N |
| XLogP | 0.84 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |