About (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one
(3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 95712790) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one.
Molecular Properties
| Compound Name | (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| PubChem CID | 95712790 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | O=C(c1ccc[nH]c1=O)N1CCC[C@@]2(C1)C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H17N3O3/c22-15-12(5-3-9-19-15)16(23)21-10-4-8-18(11-21)13-6-1-2-7-14(13)20-17(18)24/h1-3,5-7,9H,4,8,10-11H2,(H,19,22)(H,20,24)/t18-/m0/s1 |
| InChIKey | BLBBBJIFSYGYAM-SFHVURJKSA-N |
| XLogP | 1.50 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The IUPAC name of (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one (CID 95712790) is (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one.
What is the SMILES notation for (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The canonical SMILES for (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one is O=C(c1ccc[nH]c1=O)N1CCC[C@@]2(C1)C(=O)Nc1ccccc12.
What is the InChIKey of (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one?
The InChIKey is BLBBBJIFSYGYAM-SFHVURJKSA-N. The full InChI is InChI=1S/C18H17N3O3/c22-15-12(5-3-9-19-15)16(23)21-10-4-8-18(11-21)13-6-1-2-7-14(13)20-17(18)24/h1-3,5-7,9H,4,8,10-11H2,(H,19,22)(H,20,24)/t18-/m0/s1.
What are the key properties of (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one?
(3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one has a molecular weight of 323.35 g/mol, XLogP of 1.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1'-(2-oxo-1H-pyridine-3-carbonyl)spiro[1H-indole-3,3'-piperidine]-2-one is sourced from PubChem (CID 95712790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).