C20H24N4O2 — CID 95713073
1-(4-methoxyphenyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]cyclopropane-1-carboxamide (PubChem CID 95713073) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95713073 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]cyclopropane-1-carboxamide |
| SMILES | COc1ccc(C2(C(=O)N[C@@H]3CCCN(c4ncccn4)C3)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O2/c1-26-17-7-5-15(6-8-17)20(9-10-20)18(25)23-16-4-2-13-24(14-16)19-21-11-3-12-22-19/h3,5-8,11-12,16H,2,4,9-10,13-14H2,1H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | XNCVZTIUXNDNSM-MRXNPFEDSA-N |
| XLogP | 2.30 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |