About 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine
5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 95714013) has the molecular formula C18H19F3N4
and a molecular weight of 348.37 g/mol. Its IUPAC name is 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 95714013 |
| Molecular Formula | C18H19F3N4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(C)c1cc(N[C@H](C)c2ccccc2C(F)(F)F)n2nccc2n1 |
| InChI | InChI=1S/C18H19F3N4/c1-11(2)15-10-17(25-16(24-15)8-9-22-25)23-12(3)13-6-4-5-7-14(13)18(19,20)21/h4-12,23H,1-3H3/t12-/m1/s1 |
| InChIKey | MDHXLIZTBPRVJU-GFCCVEGCSA-N |
| XLogP | 5.04 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine (CID 95714013) is 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine is CC(C)c1cc(N[C@H](C)c2ccccc2C(F)(F)F)n2nccc2n1.
What is the InChIKey of 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is MDHXLIZTBPRVJU-GFCCVEGCSA-N. The full InChI is InChI=1S/C18H19F3N4/c1-11(2)15-10-17(25-16(24-15)8-9-22-25)23-12(3)13-6-4-5-7-14(13)18(19,20)21/h4-12,23H,1-3H3/t12-/m1/s1.
What are the key properties of 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine?
5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 348.37 g/mol, XLogP of 5.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-N-[(1R)-1-[2-(trifluoromethyl)phenyl]ethyl]pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 95714013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).