C15H19N3O3 — CID 95714313
(5R)-9-(2-pyridin-3-ylacetyl)-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (PubChem CID 95714313) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is (5R)-9-(2-pyridin-3-ylacetyl)-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | (5R)-9-(2-pyridin-3-ylacetyl)-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 95714313 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (5R)-9-(2-pyridin-3-ylacetyl)-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C1NC[C@]2(CCCN(C(=O)Cc3cccnc3)CC2)O1 |
| InChI | InChI=1S/C15H19N3O3/c19-13(9-12-3-1-6-16-10-12)18-7-2-4-15(5-8-18)11-17-14(20)21-15/h1,3,6,10H,2,4-5,7-9,11H2,(H,17,20)/t15-/m1/s1 |
| InChIKey | NZSLNWXBOKKKRP-OAHLLOKOSA-N |
| XLogP | 1.12 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |