About 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one
3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 95714956) has the molecular formula C18H24N4O3
and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 95714956 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CN(C)C[C@@]1(O)CCCN(C(=O)c2cnc3ccccn3c2=O)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-20(2)13-18(25)7-5-9-21(11-8-18)16(23)14-12-19-15-6-3-4-10-22(15)17(14)24/h3-4,6,10,12,25H,5,7-9,11,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | XEFSQNXRUNGNAD-GOSISDBHSA-N |
| XLogP | 0.61 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one (CID 95714956) is 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one is CN(C)C[C@@]1(O)CCCN(C(=O)c2cnc3ccccn3c2=O)CC1.
What is the InChIKey of 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one?
The InChIKey is XEFSQNXRUNGNAD-GOSISDBHSA-N. The full InChI is InChI=1S/C18H24N4O3/c1-20(2)13-18(25)7-5-9-21(11-8-18)16(23)14-12-19-15-6-3-4-10-22(15)17(14)24/h3-4,6,10,12,25H,5,7-9,11,13H2,1-2H3/t18-/m1/s1.
What are the key properties of 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one?
3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one has a molecular weight of 344.41 g/mol, XLogP of 0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-4-[(dimethylamino)methyl]-4-hydroxyazepane-1-carbonyl]pyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 95714956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).