C26H30N2O6 — CID 95715065
methyl (4S)-1-(2-methoxyethoxy)-2-oxo-8-(4-phenylbenzoyl)-1,8-diazaspiro[4.5]decane-4-carboxylate (PubChem CID 95715065) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is methyl (4S)-1-(2-methoxyethoxy)-2-oxo-8-(4-phenylbenzoyl)-1,8-diazaspiro[4.5]decane-4-carboxylate.
| Compound Name | methyl (4S)-1-(2-methoxyethoxy)-2-oxo-8-(4-phenylbenzoyl)-1,8-diazaspiro[4.5]decane-4-carboxylate |
|---|---|
| PubChem CID | 95715065 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | methyl (4S)-1-(2-methoxyethoxy)-2-oxo-8-(4-phenylbenzoyl)-1,8-diazaspiro[4.5]decane-4-carboxylate |
| SMILES | COCCON1C(=O)C[C@H](C(=O)OC)C12CCN(C(=O)c1ccc(-c3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C26H30N2O6/c1-32-16-17-34-28-23(29)18-22(25(31)33-2)26(28)12-14-27(15-13-26)24(30)21-10-8-20(9-11-21)19-6-4-3-5-7-19/h3-11,22H,12-18H2,1-2H3/t22-/m1/s1 |
| InChIKey | FOFNMAHKGXQZEY-JOCHJYFZSA-N |
| XLogP | 2.93 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|