C18H23N7O2 — CID 95717674
(9aR)-2-(6-cyclopentyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 95717674) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is (9aR)-2-(6-cyclopentyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (9aR)-2-(6-cyclopentyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 95717674 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (9aR)-2-(6-cyclopentyl-1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | Cn1ncc2c(N3CCN4C(=O)CNC(=O)[C@H]4C3)nc(C3CCCC3)nc21 |
| InChI | InChI=1S/C18H23N7O2/c1-23-16-12(8-20-23)17(22-15(21-16)11-4-2-3-5-11)24-6-7-25-13(10-24)18(27)19-9-14(25)26/h8,11,13H,2-7,9-10H2,1H3,(H,19,27)/t13-/m1/s1 |
| InChIKey | FSFODPGNCILQJT-CYBMUJFWSA-N |
| XLogP | 0.17 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |