C16H19N3O2S — CID 95720015
N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide (PubChem CID 95720015) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide.
| Compound Name | N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide |
|---|---|
| PubChem CID | 95720015 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]-2-[(3R)-morpholin-3-yl]acetamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)C[C@@H]3COCCN3)c2)cs1 |
| InChI | InChI=1S/C16H19N3O2S/c1-11-18-15(10-22-11)12-3-2-4-13(7-12)19-16(20)8-14-9-21-6-5-17-14/h2-4,7,10,14,17H,5-6,8-9H2,1H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | QTCUEELPAWTCKO-CQSZACIVSA-N |
| XLogP | 2.44 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |