C13H18N4O2 — CID 95720196
[(5S)-3,5-dimethyl-4H-1,2-oxazol-5-yl]-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)methanone (PubChem CID 95720196) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is [(5S)-3,5-dimethyl-4H-1,2-oxazol-5-yl]-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)methanone.
| Compound Name | [(5S)-3,5-dimethyl-4H-1,2-oxazol-5-yl]-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)methanone |
|---|---|
| PubChem CID | 95720196 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | [(5S)-3,5-dimethyl-4H-1,2-oxazol-5-yl]-(5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl)methanone |
| SMILES | CC1=NO[C@](C)(C(=O)N2CCCn3cncc3C2)C1 |
| InChI | InChI=1S/C13H18N4O2/c1-10-6-13(2,19-15-10)12(18)16-4-3-5-17-9-14-7-11(17)8-16/h7,9H,3-6,8H2,1-2H3/t13-/m0/s1 |
| InChIKey | KUPDRDPGIQVTEJ-ZDUSSCGKSA-N |
| XLogP | 1.17 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |