C21H33N3O2 — CID 95722246
N-butyl-2-[(2R)-1-[(4-methylphenyl)methyl]-3-oxopiperazin-2-yl]-N-propan-2-ylacetamide (PubChem CID 95722246) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is N-butyl-2-[(2R)-1-[(4-methylphenyl)methyl]-3-oxopiperazin-2-yl]-N-propan-2-ylacetamide.
| Compound Name | N-butyl-2-[(2R)-1-[(4-methylphenyl)methyl]-3-oxopiperazin-2-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 95722246 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | N-butyl-2-[(2R)-1-[(4-methylphenyl)methyl]-3-oxopiperazin-2-yl]-N-propan-2-ylacetamide |
| SMILES | CCCCN(C(=O)C[C@@H]1C(=O)NCCN1Cc1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C21H33N3O2/c1-5-6-12-24(16(2)3)20(25)14-19-21(26)22-11-13-23(19)15-18-9-7-17(4)8-10-18/h7-10,16,19H,5-6,11-15H2,1-4H3,(H,22,26)/t19-/m1/s1 |
| InChIKey | ZTCZRUVDRGADQR-LJQANCHMSA-N |
| XLogP | 2.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |