About 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile
6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile (PubChem CID 95722897) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile |
| PubChem CID | 95722897 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile |
| SMILES | CN1CCOC[C@@H](CNc2cccc(C#N)n2)C1 |
| InChI | InChI=1S/C13H18N4O/c1-17-5-6-18-10-11(9-17)8-15-13-4-2-3-12(7-14)16-13/h2-4,11H,5-6,8-10H2,1H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | MMSJFCNGVWPLPC-NSHDSACASA-N |
| XLogP | 0.94 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile?
The IUPAC name of 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile (CID 95722897) is 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile.
What is the SMILES notation for 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile?
The canonical SMILES for 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile is CN1CCOC[C@@H](CNc2cccc(C#N)n2)C1.
What is the InChIKey of 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile?
The InChIKey is MMSJFCNGVWPLPC-NSHDSACASA-N. The full InChI is InChI=1S/C13H18N4O/c1-17-5-6-18-10-11(9-17)8-15-13-4-2-3-12(7-14)16-13/h2-4,11H,5-6,8-10H2,1H3,(H,15,16)/t11-/m0/s1.
What are the key properties of 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile?
6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile has a molecular weight of 246.31 g/mol, XLogP of 0.94, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(6S)-4-methyl-1,4-oxazepan-6-yl]methylamino]pyridine-2-carbonitrile is sourced from PubChem (CID 95722897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).