C17H27N5O — CID 95722949
6-tert-butyl-1-methyl-N-[3-[(3S)-oxolan-3-yl]propyl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 95722949) has the molecular formula C17H27N5O and a molecular weight of 317.44 g/mol. Its IUPAC name is 6-tert-butyl-1-methyl-N-[3-[(3S)-oxolan-3-yl]propyl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-tert-butyl-1-methyl-N-[3-[(3S)-oxolan-3-yl]propyl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 95722949 |
| Molecular Formula | C17H27N5O |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | 6-tert-butyl-1-methyl-N-[3-[(3S)-oxolan-3-yl]propyl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Cn1ncc2c(NCCC[C@H]3CCOC3)nc(C(C)(C)C)nc21 |
| InChI | InChI=1S/C17H27N5O/c1-17(2,3)16-20-14(13-10-19-22(4)15(13)21-16)18-8-5-6-12-7-9-23-11-12/h10,12H,5-9,11H2,1-4H3,(H,18,20,21)/t12-/m0/s1 |
| InChIKey | IXCOAHOPSSDOLA-LBPRGKRZSA-N |
| XLogP | 2.89 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|