C22H25FN2O2 — CID 95723598
2-(4-ethylphenyl)-N-[(3S)-1-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]acetamide (PubChem CID 95723598) has the molecular formula C22H25FN2O2 and a molecular weight of 368.45 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-N-[(3S)-1-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]acetamide.
| Compound Name | 2-(4-ethylphenyl)-N-[(3S)-1-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 95723598 |
| Molecular Formula | C22H25FN2O2 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-(4-ethylphenyl)-N-[(3S)-1-[2-(4-fluorophenyl)ethyl]-5-oxopyrrolidin-3-yl]acetamide |
| SMILES | CCc1ccc(CC(=O)N[C@H]2CC(=O)N(CCc3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C22H25FN2O2/c1-2-16-3-5-18(6-4-16)13-21(26)24-20-14-22(27)25(15-20)12-11-17-7-9-19(23)10-8-17/h3-10,20H,2,11-15H2,1H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | MRPBKDJJIVNKMX-FQEVSTJZSA-N |
| XLogP | 2.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |